CAS 59557-05-0 appears in our catalog under these names: Butanoic acid, 3-oxo-, (1r,2s,5r)-5-methyl-2-(1-methylethyl)cyclohexyl ester, 95%, (1S,2R,5S)–5–methyl–2–(propan–2–yl)cyclohexyl 3–oxobutanoate, Butanoic acid, 3-oxo-,(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxobutanoate (CAS 59557-05-0) is a chemical compound with the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxobutanoate. InChIKey: QSVQIPXQOCAWHP-KGYLQXTDSA-N.
| Molecular formula | C14H24O3 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxobutanoate |
| InChIKey | QSVQIPXQOCAWHP-KGYLQXTDSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CC(=O)C)C(C)C |
Computed by PubChem (NCBI)