Products 59591-14-9
CAS 59591-14-9 is the registry number for rac-(3aR,6aR)-2-Oxo-octahydropentalene-3a-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3aR,6aR)-5-oxo-1,2,3,4,6,6a-hexahydropentalene-3a-carboxylic acid (CAS 59591-14-9) is a chemical compound with the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. IUPAC name: (3aR,6aR)-5-oxo-1,2,3,4,6,6a-hexahydropentalene-3a-carboxylic acid. InChIKey: ODHAOFSDMDOEGL-HZGVNTEJSA-N.
| Molecular formula | C9H12O3 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | (3aR,6aR)-5-oxo-1,2,3,4,6,6a-hexahydropentalene-3a-carboxylic acid |
| InChIKey | ODHAOFSDMDOEGL-HZGVNTEJSA-N |
| SMILES | C1C[C@@H]2CC(=O)C[C@@]2(C1)C(=O)O |
Computed by PubChem (NCBI)