Products 596093-97-9
CAS 596093-97-9 is the registry number for Lepidiline B. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5 mg, 10 mg.
1,3-dibenzyl-2,4,5-trimethylimidazol-1-ium chloride (CAS 596093-97-9) is a chemical compound with the molecular formula C20H23ClN2 and a molecular weight of 326.9 g/mol. IUPAC name: 1,3-dibenzyl-2,4,5-trimethylimidazol-1-ium chloride. InChIKey: VVNHJXQBUXJGBN-UHFFFAOYSA-M.
| Molecular formula | C20H23ClN2 |
|---|---|
| Molecular weight | 326.9 g/mol |
| IUPAC name | 1,3-dibenzyl-2,4,5-trimethylimidazol-1-ium chloride |
| InChIKey | VVNHJXQBUXJGBN-UHFFFAOYSA-M |
| SMILES | CC1=C([N+](=C(N1CC2=CC=CC=C2)C)CC3=CC=CC=C3)C.[Cl-] |
Computed by PubChem (NCBI)