Products 59616-63-6

CAS 59616-63-6 is the registry number for Bis(perfluorophenyl) phenyl phosphate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Bis(2,3,4,5,6-pentafluorophenyl) phenyl phosphate (CAS 59616-63-6) is a chemical compound with the molecular formula C18H5F10O4P and a molecular weight of 506.2 g/mol. IUPAC name: bis(2,3,4,5,6-pentafluorophenyl) phenyl phosphate. InChIKey: QGGSSFMIXKESPP-UHFFFAOYSA-N.

Identity
Molecular formulaC18H5F10O4P
Molecular weight506.2 g/mol
IUPAC namebis(2,3,4,5,6-pentafluorophenyl) phenyl phosphate
InChIKeyQGGSSFMIXKESPP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)OP(=O)(OC2=C(C(=C(C(=C2F)F)F)F)F)OC3=C(C(=C(C(=C3F)F)F)F)F

Computed by PubChem (NCBI)