CAS 59665-28-0 is the registry number for 1,2-Dibromo-1-(perfluoro-n-hexyl)ethylene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
1,2-dibromo-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-ene (CAS 59665-28-0) is a chemical compound with the molecular formula C8HBr2F13 and a molecular weight of 503.88 g/mol. IUPAC name: 1,2-dibromo-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-ene. InChIKey: YCJFSPFBPAMUCR-UHFFFAOYSA-N.
| Molecular formula | C8HBr2F13 |
|---|---|
| Molecular weight | 503.88 g/mol |
| IUPAC name | 1,2-dibromo-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-ene |
| InChIKey | YCJFSPFBPAMUCR-UHFFFAOYSA-N |
| SMILES | C(=C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Br)Br |
Computed by PubChem (NCBI)