CAS 596850-17-8 appears in our catalog under these names: 2-Fluoro-4-(trifluoromethylthio)aniline, 95%, 2-Fluoro-4-((trifluoromethyl)thio)aniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-fluoro-4-(trifluoromethylsulfanyl)aniline (CAS 596850-17-8) is a chemical compound with the molecular formula C7H5F4NS and a molecular weight of 211.18 g/mol. IUPAC name: 2-fluoro-4-(trifluoromethylsulfanyl)aniline. InChIKey: QNQRDYVNFVFUES-UHFFFAOYSA-N.
| Molecular formula | C7H5F4NS |
|---|---|
| Molecular weight | 211.18 g/mol |
| IUPAC name | 2-fluoro-4-(trifluoromethylsulfanyl)aniline |
| InChIKey | QNQRDYVNFVFUES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1SC(F)(F)F)F)N |
Computed by PubChem (NCBI)