Products 59709-38-5
CAS 59709-38-5 is the registry number for Yellow brown XF. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 3-[4-[(2-bromo-6-chloro-4-nitrophenyl)diazenyl]-N-(3-methoxy-3-oxopropyl)anilino]propanoate (CAS 59709-38-5) is a chemical compound with the molecular formula C20H20BrClN4O6 and a molecular weight of 527.8 g/mol. IUPAC name: methyl 3-[4-[(2-bromo-6-chloro-4-nitrophenyl)diazenyl]-N-(3-methoxy-3-oxopropyl)anilino]propanoate. InChIKey: SGXLDQRCIYZKPS-UHFFFAOYSA-N.
| Molecular formula | C20H20BrClN4O6 |
|---|---|
| Molecular weight | 527.8 g/mol |
| IUPAC name | methyl 3-[4-[(2-bromo-6-chloro-4-nitrophenyl)diazenyl]-N-(3-methoxy-3-oxopropyl)anilino]propanoate |
| InChIKey | SGXLDQRCIYZKPS-UHFFFAOYSA-N |
| SMILES | COC(=O)CCN(CCC(=O)OC)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2Br)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)