CAS 5971-93-7 appears in our catalog under these names: Rubidium tetraphenylborate, 95%, Rubidium tetraphenylborate. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
Rubidium(1+);tetraphenylboranuide (CAS 5971-93-7) is a chemical compound with the molecular formula C24H20BRb and a molecular weight of 404.7 g/mol. IUPAC name: rubidium(1+);tetraphenylboranuide. InChIKey: SQJLZQVNFRBQQI-UHFFFAOYSA-N.
| Molecular formula | C24H20BRb |
|---|---|
| Molecular weight | 404.7 g/mol |
| IUPAC name | rubidium(1+);tetraphenylboranuide |
| InChIKey | SQJLZQVNFRBQQI-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Rb+] |
Computed by PubChem (NCBI)