Products 59713-55-2
CAS 59713-55-2 is the registry number for tert-Butyl 2-amino-4H,5H,6H-cyclopenta(b)thiophene-3-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Tert-butyl 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (CAS 59713-55-2) is a chemical compound with the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. IUPAC name: tert-butyl 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate. InChIKey: OMFVRGPHQLADHO-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2S |
|---|---|
| Molecular weight | 239.34 g/mol |
| IUPAC name | tert-butyl 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| InChIKey | OMFVRGPHQLADHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(SC2=C1CCC2)N |
Computed by PubChem (NCBI)