CAS 59768-12-6 appears in our catalog under these names: 2,5-Dichloro-4-nitrothiophene-3-sulphonyl chloride, 95%, 2,5-Dichloro-4-nitrothiophene-3-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2,5-dichloro-4-nitrothiophene-3-sulfonyl chloride (CAS 59768-12-6) is a chemical compound with the molecular formula C4Cl3NO4S2 and a molecular weight of 296.5 g/mol. IUPAC name: 2,5-dichloro-4-nitrothiophene-3-sulfonyl chloride. InChIKey: RKORQLAKLUIWLQ-UHFFFAOYSA-N.
| Molecular formula | C4Cl3NO4S2 |
|---|---|
| Molecular weight | 296.5 g/mol |
| IUPAC name | 2,5-dichloro-4-nitrothiophene-3-sulfonyl chloride |
| InChIKey | RKORQLAKLUIWLQ-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=C1S(=O)(=O)Cl)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)