Products 59768-12-6

CAS 59768-12-6 appears in our catalog under these names: 2,5-Dichloro-4-nitrothiophene-3-sulphonyl chloride, 95%, 2,5-Dichloro-4-nitrothiophene-3-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

2,5-dichloro-4-nitrothiophene-3-sulfonyl chloride (CAS 59768-12-6) is a chemical compound with the molecular formula C4Cl3NO4S2 and a molecular weight of 296.5 g/mol. IUPAC name: 2,5-dichloro-4-nitrothiophene-3-sulfonyl chloride. InChIKey: RKORQLAKLUIWLQ-UHFFFAOYSA-N.

Identity
Molecular formulaC4Cl3NO4S2
Molecular weight296.5 g/mol
IUPAC name2,5-dichloro-4-nitrothiophene-3-sulfonyl chloride
InChIKeyRKORQLAKLUIWLQ-UHFFFAOYSA-N
SMILESC1(=C(SC(=C1S(=O)(=O)Cl)Cl)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)