CAS 59776-60-2 is the registry number for 1-isocyanato-3,5-dinitrobenzene. Offered by: TRC. Available pack sizes: 250mg.
1-isocyanato-3,5-dinitrobenzene (CAS 59776-60-2) is a chemical compound with the molecular formula C7H3N3O5 and a molecular weight of 209.12 g/mol. IUPAC name: 1-isocyanato-3,5-dinitrobenzene. InChIKey: JZPRXQSCMBDGKP-UHFFFAOYSA-N.
| Molecular formula | C7H3N3O5 |
|---|---|
| Molecular weight | 209.12 g/mol |
| IUPAC name | 1-isocyanato-3,5-dinitrobenzene |
| InChIKey | JZPRXQSCMBDGKP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])N=C=O |
Computed by PubChem (NCBI)