CAS 5978-87-0 is the registry number for Riboflavin Impurity R. Offered by: Chemat Brand. Available pack sizes: on request.
7,8-dimethyl-10-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione (CAS 5978-87-0) is a chemical compound with the molecular formula C17H20N4O6 and a molecular weight of 376.4 g/mol. IUPAC name: 7,8-dimethyl-10-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione. InChIKey: AUNGANRZJHBGPY-BZPMIXESSA-N.
| Molecular formula | C17H20N4O6 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 7,8-dimethyl-10-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione |
| InChIKey | AUNGANRZJHBGPY-BZPMIXESSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)C[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)