Products 59785-69-2

CAS 59785-69-2 is the registry number for Captopril Impurity 35. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R)-1-(2-methylpropanoyl)pyrrolidine-2-carboxylic acid (CAS 59785-69-2) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: (2R)-1-(2-methylpropanoyl)pyrrolidine-2-carboxylic acid. InChIKey: WKQUFVTUGGLNNO-SSDOTTSWSA-N.

Identity
Molecular formulaC9H15NO3
Molecular weight185.22 g/mol
IUPAC name(2R)-1-(2-methylpropanoyl)pyrrolidine-2-carboxylic acid
InChIKeyWKQUFVTUGGLNNO-SSDOTTSWSA-N
SMILESCC(C)C(=O)N1CCC[C@@H]1C(=O)O

Computed by PubChem (NCBI)