CAS 5979-01-1 appears in our catalog under these names: 4,6-Pteridinedione, 2-amino-3,5-dihydro-, hydrate (1:1), ≥98%, ≥98%, Xanthopterin monohydrate, 95%, 2-Amino-3,5-dihydropteridine-4,6-dione, 95%, Xanthopterin Hydrate, Xanthopterin (hydrate). Offered by: Chemat, Combi-blocks, TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 250mg, 1g, 5g, 100mg, 10mM (in 1ml dmso), Get quote, 10mM/1mL.
2-amino-3,5-dihydropteridine-4,6-dione;hydrate (CAS 5979-01-1) is a chemical compound with the molecular formula C6H7N5O3 and a molecular weight of 197.15 g/mol. IUPAC name: 2-amino-3,5-dihydropteridine-4,6-dione;hydrate. InChIKey: GXYCFNCAIXIUMR-UHFFFAOYSA-N.
| Molecular formula | C6H7N5O3 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | 2-amino-3,5-dihydropteridine-4,6-dione;hydrate |
| InChIKey | GXYCFNCAIXIUMR-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=O)NC(=N2)N)NC1=O.O |
Computed by PubChem (NCBI)