Products 5981-18-0
CAS 5981-18-0 appears in our catalog under these names: Trisalicylide, Deferasirox Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
2,10,18-trioxatetracyclo[18.4.0.04,9.012,17]tetracosa-1(24),4,6,8,12,14,16,20,22-nonaene-3,11,19-trione (CAS 5981-18-0) is a chemical compound with the molecular formula C21H12O6 and a molecular weight of 360.3 g/mol. IUPAC name: 2,10,18-trioxatetracyclo[18.4.0.04,9.012,17]tetracosa-1(24),4,6,8,12,14,16,20,22-nonaene-3,11,19-trione. InChIKey: KYLIMUJRJDIPPF-UHFFFAOYSA-N.
| Molecular formula | C21H12O6 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 2,10,18-trioxatetracyclo[18.4.0.04,9.012,17]tetracosa-1(24),4,6,8,12,14,16,20,22-nonaene-3,11,19-trione |
| InChIKey | KYLIMUJRJDIPPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC3=CC=CC=C3C(=O)OC4=CC=CC=C4C(=O)O2 |
Computed by PubChem (NCBI)