Products 59812-36-1

CAS 59812-36-1 is the registry number for 3-Chloro-6-nitro-benzo(b)thiophene-2-carboxylic acid methyl ester. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-chloro-6-nitro-1-benzothiophene-2-carboxylate (CAS 59812-36-1) is a chemical compound with the molecular formula C10H6ClNO4S and a molecular weight of 271.68 g/mol. IUPAC name: methyl 3-chloro-6-nitro-1-benzothiophene-2-carboxylate. InChIKey: VFXPDLXMSOHMNK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6ClNO4S
Molecular weight271.68 g/mol
IUPAC namemethyl 3-chloro-6-nitro-1-benzothiophene-2-carboxylate
InChIKeyVFXPDLXMSOHMNK-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C2=C(S1)C=C(C=C2)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)