CAS 59823-94-8 is the registry number for Europium(II) acetate, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Europium(2+) diacetate (CAS 59823-94-8) is a chemical compound with the molecular formula C4H6EuO4 and a molecular weight of 270.05 g/mol. IUPAC name: europium(2+) diacetate. InChIKey: JABSKJKXYGWLSD-UHFFFAOYSA-L.
| Molecular formula | C4H6EuO4 |
|---|---|
| Molecular weight | 270.05 g/mol |
| IUPAC name | europium(2+) diacetate |
| InChIKey | JABSKJKXYGWLSD-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Eu+2] |
Computed by PubChem (NCBI)