Products 5984-50-9

CAS 5984-50-9 is the registry number for Isometheptane Tartrate (Dimethylheptene Methylamine Tartrate). Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R,3R)-2,3-dihydroxybutanedioic acid;N,6-dimethylhept-5-en-2-amine (CAS 5984-50-9) is a chemical compound with the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;N,6-dimethylhept-5-en-2-amine. InChIKey: HLRDXBKIKFQOFS-LREBCSMRSA-N.

Identity
Molecular formulaC13H25NO6
Molecular weight291.34 g/mol
IUPAC name(2R,3R)-2,3-dihydroxybutanedioic acid;N,6-dimethylhept-5-en-2-amine
InChIKeyHLRDXBKIKFQOFS-LREBCSMRSA-N
SMILESCC(CCC=C(C)C)NC.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O

Computed by PubChem (NCBI)