CAS 5984-50-9 is the registry number for Isometheptane Tartrate (Dimethylheptene Methylamine Tartrate). Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-2,3-dihydroxybutanedioic acid;N,6-dimethylhept-5-en-2-amine (CAS 5984-50-9) is a chemical compound with the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;N,6-dimethylhept-5-en-2-amine. InChIKey: HLRDXBKIKFQOFS-LREBCSMRSA-N.
| Molecular formula | C13H25NO6 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;N,6-dimethylhept-5-en-2-amine |
| InChIKey | HLRDXBKIKFQOFS-LREBCSMRSA-N |
| SMILES | CC(CCC=C(C)C)NC.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)