CAS 59863-13-7 is the registry number for BIS(BIS(TRIMETHYLSILYL)AMINO)TIN II. Offered by: GLPBio. Available pack sizes: 5ml.
Bis[bis(trimethylsilyl)amino]tin (CAS 59863-13-7) is a chemical compound with the molecular formula C12H36N2Si4Sn and a molecular weight of 439.48 g/mol. IUPAC name: bis[bis(trimethylsilyl)amino]tin. InChIKey: WLNIUEYAQZRJFS-UHFFFAOYSA-N.
| Molecular formula | C12H36N2Si4Sn |
|---|---|
| Molecular weight | 439.48 g/mol |
| IUPAC name | bis[bis(trimethylsilyl)amino]tin |
| InChIKey | WLNIUEYAQZRJFS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N([Si](C)(C)C)[Sn]N([Si](C)(C)C)[Si](C)(C)C |
Computed by PubChem (NCBI)