CAS 59864-79-8 appears in our catalog under these names: Ammonium dodecanedioate, 98%, 1,10-Decanedicarboxylic acid xammonium salt, 97%, Ammonium dodecanedioate, Ammonium dodecanedioate, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 25g, 100g, 5g, 1g.
Diazanium;dodecanedioate (CAS 59864-79-8) is a chemical compound with the molecular formula C12H28N2O4 and a molecular weight of 264.36 g/mol. IUPAC name: diazanium;dodecanedioate. InChIKey: GPEVMRFAFMVKHK-UHFFFAOYSA-N.
| Molecular formula | C12H28N2O4 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | diazanium;dodecanedioate |
| InChIKey | GPEVMRFAFMVKHK-UHFFFAOYSA-N |
| SMILES | C(CCCCCC(=O)[O-])CCCCC(=O)[O-].[NH4+].[NH4+] |
Computed by PubChem (NCBI)