CAS 59865-23-5 appears in our catalog under these names: Cyclosporin Impurity 4, 4-(2E)-2-Buten-1-yl-2,4,5-trideoxy-2-(methylamino)-L-xylonic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(E,2S,3R,4R)-3-hydroxy-4-methyl-2-(methylamino)oct-6-enoic acid (CAS 59865-23-5) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: (E,2S,3R,4R)-3-hydroxy-4-methyl-2-(methylamino)oct-6-enoic acid. InChIKey: AHQFCPOIMVMDEZ-UNISNWAASA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | (E,2S,3R,4R)-3-hydroxy-4-methyl-2-(methylamino)oct-6-enoic acid |
| InChIKey | AHQFCPOIMVMDEZ-UNISNWAASA-N |
| SMILES | C/C=C/C[C@@H](C)[C@H]([C@@H](C(=O)O)NC)O |
Computed by PubChem (NCBI)