CAS 5987-82-6 appears in our catalog under these names: Oxybuprocaine hydrochloride, 95%, Oxybuprocaine HCl, Procaine Impurity 9 (Benoxinate Hydrochloride), Oxybuprocaine Hydrochloride, Benoxinate Hydrochloride, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: 1g, 5g, 10g, 25g, on request, 10mg, 25mg, 50mg.
2-(diethylamino)ethyl 4-amino-3-butoxybenzoate;hydrochloride (CAS 5987-82-6) is a chemical compound with the molecular formula C17H29ClN2O3 and a molecular weight of 344.9 g/mol. IUPAC name: 2-(diethylamino)ethyl 4-amino-3-butoxybenzoate;hydrochloride. InChIKey: PRGUDWLMFLCODA-UHFFFAOYSA-N.
| Molecular formula | C17H29ClN2O3 |
|---|---|
| Molecular weight | 344.9 g/mol |
| IUPAC name | 2-(diethylamino)ethyl 4-amino-3-butoxybenzoate;hydrochloride |
| InChIKey | PRGUDWLMFLCODA-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C=CC(=C1)C(=O)OCCN(CC)CC)N.Cl |
Computed by PubChem (NCBI)