CAS 59875-58-0 appears in our catalog under these names: Nimodipine Impurity 13(Dehydro Nicardipine), Nicardipine hydrochloride EP Impurity A, Nicardipine EP Impurity A (Dehydro Nicardipine), Dehydro Nicardipine. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 50mg, Get quote.
3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (CAS 59875-58-0) is a chemical compound with the molecular formula C26H27N3O6 and a molecular weight of 477.5 g/mol. IUPAC name: 3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate. InChIKey: GROZWIBBDLLXKU-UHFFFAOYSA-N.
| Molecular formula | C26H27N3O6 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | 3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| InChIKey | GROZWIBBDLLXKU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OCCN(C)CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)