CAS 59876-72-1 is the registry number for N-(3,5-Dichloro-4-hydroxyphenyl)-4-methylbenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3,5-dichloro-4-hydroxyphenyl)-4-methylbenzenesulfonamide (CAS 59876-72-1) is a chemical compound with the molecular formula C13H11Cl2NO3S and a molecular weight of 332.2 g/mol. IUPAC name: N-(3,5-dichloro-4-hydroxyphenyl)-4-methylbenzenesulfonamide. InChIKey: LKXDNKFSHKMSPO-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO3S |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | N-(3,5-dichloro-4-hydroxyphenyl)-4-methylbenzenesulfonamide |
| InChIKey | LKXDNKFSHKMSPO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C(=C2)Cl)O)Cl |
Computed by PubChem (NCBI)