CAS 59898-59-8 is the registry number for 2-Mercapto-3,5,6-trimethylthieno[2,3-d]pyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,5,6-trimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 59898-59-8) is a chemical compound with the molecular formula C9H10N2OS2 and a molecular weight of 226.3 g/mol. IUPAC name: 3,5,6-trimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: GNCWNPBBEFFQFM-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS2 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 3,5,6-trimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | GNCWNPBBEFFQFM-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)N(C(=S)N2)C)C |
Computed by PubChem (NCBI)