Products 599177-24-9
CAS 599177-24-9 appears in our catalog under these names: VIS-583 Trimethine-, Cyanine PF6-, 1 g, glass, VIS-583 Trimethine-, Cyanine PF6-, 5 g, plastic, VIS-583 Trimethine-, Cyanine PF6-, 10 g, plastic. Offered by: Roth. Available pack sizes: 1g, 5g, 10g.
(2E)-1,1,3-trimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indole hexafluorophosphate (CAS 599177-24-9) is a chemical compound with the molecular formula C33H33F6N2P and a molecular weight of 602.6 g/mol. IUPAC name: (2E)-1,1,3-trimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indole hexafluorophosphate. InChIKey: YFUKIPVAWNUVSU-UHFFFAOYSA-N.
| Molecular formula | C33H33F6N2P |
|---|---|
| Molecular weight | 602.6 g/mol |
| IUPAC name | (2E)-1,1,3-trimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indole hexafluorophosphate |
| InChIKey | YFUKIPVAWNUVSU-UHFFFAOYSA-N |
| SMILES | CC1(C(=[N+](C2=C1C3=CC=CC=C3C=C2)C)/C=C/C=C/4\C(C5=C(N4C)C=CC6=CC=CC=C65)(C)C)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Dye 837