CAS 59923-19-2 appears in our catalog under these names: 4-(3-Nitro-benzenesulfonylamino)-benzoic acid, 95%, 4-(3-Nitro-benzenesulfonylamino)-benzoic acid, 4-(3-Nitro-benzenesulfonylamino)-benzoic acid, ≥98%, ≥98%, 4-(3-Nitrobenzenesulfonamido)benzoic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 5mg, 10mg, 25mg.
4-[(3-nitrophenyl)sulfonylamino]benzoic acid (CAS 59923-19-2) is a chemical compound with the molecular formula C13H10N2O6S and a molecular weight of 322.30 g/mol. IUPAC name: 4-[(3-nitrophenyl)sulfonylamino]benzoic acid. InChIKey: CXOGYGMKNVZTHS-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O6S |
|---|---|
| Molecular weight | 322.30 g/mol |
| IUPAC name | 4-[(3-nitrophenyl)sulfonylamino]benzoic acid |
| InChIKey | CXOGYGMKNVZTHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC2=CC=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)