Products 59960-34-8
CAS 59960-34-8 is the registry number for Alclofenac (lysinate). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(3-chloro-4-prop-2-enoxyphenyl)acetic acid;(2S)-2,6-diaminohexanoic acid (CAS 59960-34-8) is a chemical compound with the molecular formula C17H25ClN2O5 and a molecular weight of 372.8 g/mol. IUPAC name: 2-(3-chloro-4-prop-2-enoxyphenyl)acetic acid;(2S)-2,6-diaminohexanoic acid. InChIKey: YDINFUGJNRFTDV-ZSCHJXSPSA-N.
| Molecular formula | C17H25ClN2O5 |
|---|---|
| Molecular weight | 372.8 g/mol |
| IUPAC name | 2-(3-chloro-4-prop-2-enoxyphenyl)acetic acid;(2S)-2,6-diaminohexanoic acid |
| InChIKey | YDINFUGJNRFTDV-ZSCHJXSPSA-N |
| SMILES | C=CCOC1=C(C=C(C=C1)CC(=O)O)Cl.C(CCN)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)