Products 59994-64-8
CAS 59994-64-8 is the registry number for hCAIX/XII-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[2-(2,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]benzenesulfonamide (CAS 59994-64-8) is a chemical compound with the molecular formula C16H13Cl2N5O3S and a molecular weight of 426.3 g/mol. IUPAC name: 4-[[2-(2,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]benzenesulfonamide. InChIKey: VNQGMWWJUNKCJL-UHFFFAOYSA-N.
| Molecular formula | C16H13Cl2N5O3S |
|---|---|
| Molecular weight | 426.3 g/mol |
| IUPAC name | 4-[[2-(2,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]benzenesulfonamide |
| InChIKey | VNQGMWWJUNKCJL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1)C2=C(C=C(C=C2)Cl)Cl)N=NC3=CC=C(C=C3)S(=O)(=O)N |
Computed by PubChem (NCBI)
Synonyms:
hCAIX/XII-IN-8, orb2277713