CAS 600-40-8 is the registry number for 1,1-Dinitroethane. Offered by: TRC. Available pack sizes: 5g.
1,1-dinitroethane (CAS 600-40-8) is a chemical compound with the molecular formula C2H4N2O4 and a molecular weight of 120.06 g/mol. IUPAC name: 1,1-dinitroethane. InChIKey: LKKHEZBRRGJBGH-UHFFFAOYSA-N.
| Molecular formula | C2H4N2O4 |
|---|---|
| Molecular weight | 120.06 g/mol |
| IUPAC name | 1,1-dinitroethane |
| InChIKey | LKKHEZBRRGJBGH-UHFFFAOYSA-N |
| SMILES | CC([N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)