CAS 6001-64-5 appears in our catalog under these names: Chlorbutanol Hemihydrate, >95% (HPLC), Chlorobutanol Hemihydrate, Acetonchloroform hemihydrate, 1,1,1-Trichloro-2-methyl-2-propanol hemihydrate, 98% , Chlorobutanol, 98.00%. Offered by: TRC, Mikromol, LoGiCal, Dr. Ehrenstorfer, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 10g, 500mg, 10mg, 1g, 25g, 250g, 500g.
Bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate (CAS 6001-64-5) is a chemical compound with the molecular formula C8H16Cl6O3 and a molecular weight of 372.9 g/mol. IUPAC name: bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate. InChIKey: WRWLCXJYIMRJIN-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl6O3 |
|---|---|
| Molecular weight | 372.9 g/mol |
| IUPAC name | bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate |
| InChIKey | WRWLCXJYIMRJIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C(Cl)(Cl)Cl)O.CC(C)(C(Cl)(Cl)Cl)O.O |
Computed by PubChem (NCBI)