CAS 60029-40-5 is the registry number for 3-(Adamantan-1-yl)aniline, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(1-adamantyl)aniline (CAS 60029-40-5) is a chemical compound with the molecular formula C16H21N and a molecular weight of 227.34 g/mol. IUPAC name: 3-(1-adamantyl)aniline. InChIKey: OBFAXQWBRQNVCL-UHFFFAOYSA-N.
| Molecular formula | C16H21N |
|---|---|
| Molecular weight | 227.34 g/mol |
| IUPAC name | 3-(1-adamantyl)aniline |
| InChIKey | OBFAXQWBRQNVCL-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC(=CC=C4)N |
Computed by PubChem (NCBI)