CAS 6003-94-7 appears in our catalog under these names: Chelidonic acid monohydrate, 95%, Chelidonic Acid Monohydrate, Chelidonic Acid Monohydrate, >95.0%(T), Chelidonic acid monohydrate, Chelidonic Acid Monohydrate, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 50g, 250mg, 100mg.
4-oxopyran-2,6-dicarboxylic acid;hydrate (CAS 6003-94-7) is a chemical compound with the molecular formula C7H6O7 and a molecular weight of 202.12 g/mol. IUPAC name: 4-oxopyran-2,6-dicarboxylic acid;hydrate. InChIKey: KJZJAKSEIQOKAK-UHFFFAOYSA-N.
| Molecular formula | C7H6O7 |
|---|---|
| Molecular weight | 202.12 g/mol |
| IUPAC name | 4-oxopyran-2,6-dicarboxylic acid;hydrate |
| InChIKey | KJZJAKSEIQOKAK-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=CC1=O)C(=O)O)C(=O)O.O |
Computed by PubChem (NCBI)