CAS 60081-73-4 is the registry number for Sodium 4–Vinylbenzenesulfinate. Offered by: GLPBio. Available pack sizes: 250mg.
Sodium 4-ethenylbenzenesulfinate (CAS 60081-73-4) is a chemical compound with the molecular formula C8H7NaO2S and a molecular weight of 190.20 g/mol. IUPAC name: sodium 4-ethenylbenzenesulfinate. InChIKey: RGZJTTDABHNRPI-UHFFFAOYSA-M.
| Molecular formula | C8H7NaO2S |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | sodium 4-ethenylbenzenesulfinate |
| InChIKey | RGZJTTDABHNRPI-UHFFFAOYSA-M |
| SMILES | C=CC1=CC=C(C=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)