CAS 60091-05-6 is the registry number for 6,2'-Dimethyladenosine 5'-Monophosphate. Offered by: TRC. Available pack sizes: 25mg.
[(2R,3R,4R,5R)-3-hydroxy-4-methoxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate (CAS 60091-05-6) is a chemical compound with the molecular formula C12H18N5O7P and a molecular weight of 375.27 g/mol. IUPAC name: [(2R,3R,4R,5R)-3-hydroxy-4-methoxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate. InChIKey: RCPFPDICXYXAPF-WOUKDFQISA-N.
| Molecular formula | C12H18N5O7P |
|---|---|
| Molecular weight | 375.27 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3-hydroxy-4-methoxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | RCPFPDICXYXAPF-WOUKDFQISA-N |
| SMILES | CNC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)OC |
Computed by PubChem (NCBI)