CAS 60106-92-5 appears in our catalog under these names: Tetrakis(2-chloroethyl)phosphorodiamidic Chloride, Tetrakis(2-chloroethyl)phosphorodiamidic Chloride, 98%, 98%. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 1g, 5000mg, 250mg.
N-[bis(2-chloroethyl)amino-chlorophosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine (CAS 60106-92-5) is a chemical compound with the molecular formula C8H16Cl5N2OP and a molecular weight of 364.5 g/mol. IUPAC name: N-[bis(2-chloroethyl)amino-chlorophosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine. InChIKey: QXUFUUCHZZBJNO-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl5N2OP |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | N-[bis(2-chloroethyl)amino-chlorophosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
| InChIKey | QXUFUUCHZZBJNO-UHFFFAOYSA-N |
| SMILES | C(CCl)N(CCCl)P(=O)(N(CCCl)CCCl)Cl |
Computed by PubChem (NCBI)