Products 60108-51-2
CAS 60108-51-2 is the registry number for H-Val-Pro-OtBu·HCl. Offered by: Biosynth. Available pack sizes: 5000mg, 2000mg, 10000mg.
Tert-butyl (2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidine-2-carboxylate;hydrochloride (CAS 60108-51-2) is a chemical compound with the molecular formula C14H27ClN2O3 and a molecular weight of 306.83 g/mol. IUPAC name: tert-butyl (2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidine-2-carboxylate;hydrochloride. InChIKey: AFLLLGQZFVJBBK-ACMTZBLWSA-N.
| Molecular formula | C14H27ClN2O3 |
|---|---|
| Molecular weight | 306.83 g/mol |
| IUPAC name | tert-butyl (2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | AFLLLGQZFVJBBK-ACMTZBLWSA-N |
| SMILES | CC(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)