CAS 60117-35-3 appears in our catalog under these names: Anb-Nos Crosslinker, ANB–NOS, N-Succinimidyl 5-Azido-2-nitrobenzoate, >97.0%(HPLC), ANB-NOS, 98.02%, N-5-Azido-2-nitrobenzoyloxysuccinimide, 98%, 98%. Offered by: TRC, GLPBio, TCI, MedChemExpress, Chemat. Available pack sizes: 50mg, 10mg, 100 mg, 10 mg, 50 mg, 5 mg, 25 mg.
(2,5-dioxopyrrolidin-1-yl) 5-azido-2-nitrobenzoate (CAS 60117-35-3) is a chemical compound with the molecular formula C11H7N5O6 and a molecular weight of 305.20 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 5-azido-2-nitrobenzoate. InChIKey: FUOJEDZPVVDXHI-UHFFFAOYSA-N.
| Molecular formula | C11H7N5O6 |
|---|---|
| Molecular weight | 305.20 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 5-azido-2-nitrobenzoate |
| InChIKey | FUOJEDZPVVDXHI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=C(C=CC(=C2)N=[N+]=[N-])[N+](=O)[O-] |
Computed by PubChem (NCBI)