CAS 60124-83-6 is the registry number for Anthranilic-3,4,5,6-d4 Acid, 97 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
2-amino-3,4,5,6-tetradeuteriobenzoic acid (CAS 60124-83-6) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 141.16 g/mol. IUPAC name: 2-amino-3,4,5,6-tetradeuteriobenzoic acid. InChIKey: RWZYAGGXGHYGMB-RHQRLBAQSA-N.
| Molecular formula | C7H7NO2 |
|---|---|
| Molecular weight | 141.16 g/mol |
| IUPAC name | 2-amino-3,4,5,6-tetradeuteriobenzoic acid |
| InChIKey | RWZYAGGXGHYGMB-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)