CAS 60124-86-9 appears in our catalog under these names: Phencyclidine-D5 (PCP-D5) 0.1 mg/ml in Methanol, Phencyclidine-D5 (PCP-D5) 1.0 mg/ml in Methanol. Offered by: LoGiCal. Available pack sizes: 1ml.
1-[1-(2,3,4,5,6-pentadeuteriophenyl)cyclohexyl]piperidine (CAS 60124-86-9) is a chemical compound with the molecular formula C17H25N and a molecular weight of 248.42 g/mol. IUPAC name: 1-[1-(2,3,4,5,6-pentadeuteriophenyl)cyclohexyl]piperidine. InChIKey: JTJMJGYZQZDUJJ-ZWYOJXJXSA-N.
| Molecular formula | C17H25N |
|---|---|
| Molecular weight | 248.42 g/mol |
| IUPAC name | 1-[1-(2,3,4,5,6-pentadeuteriophenyl)cyclohexyl]piperidine |
| InChIKey | JTJMJGYZQZDUJJ-ZWYOJXJXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2(CCCCC2)N3CCCCC3)[2H])[2H] |
Computed by PubChem (NCBI)