Products 60124-88-1
CAS 60124-88-1 appears in our catalog under these names: DL-Methamphetamine-d5, rac-Methamphetamine-D5 0.1 mg/ml in Methanol, rac-Methamphetamine-D5 1.0 mg/ml in Methanol, rac-Methamphetamine-d5. Offered by: TRC, LoGiCal, Biosynth. Available pack sizes: 100mg, 1ml, 50mg, 25mg.
1,2-dideuterio-1-phenyl-N-(trideuteriomethyl)propan-2-amine (CAS 60124-88-1) is a chemical compound with the molecular formula C10H15N and a molecular weight of 154.26 g/mol. IUPAC name: 1,2-dideuterio-1-phenyl-N-(trideuteriomethyl)propan-2-amine. InChIKey: MYWUZJCMWCOHBA-CXVYKYTNSA-N.
| Molecular formula | C10H15N |
|---|---|
| Molecular weight | 154.26 g/mol |
| IUPAC name | 1,2-dideuterio-1-phenyl-N-(trideuteriomethyl)propan-2-amine |
| InChIKey | MYWUZJCMWCOHBA-CXVYKYTNSA-N |
| SMILES | [2H]C(C1=CC=CC=C1)C([2H])(C)NC([2H])([2H])[2H] |
Computed by PubChem (NCBI)