CAS 60126-29-6 appears in our catalog under these names: 2–Methyl–3–propylbenzothiazolium iodide, 2-Methyl-3-propylbenzothiazolium iodide, 97%, 97%, 2-METHYL-3-PROPYLBENZOTHIAZOLIUM IODIDE, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 10g.
2-methyl-3-propyl-1,3-benzothiazol-3-ium iodide (CAS 60126-29-6) is a chemical compound with the molecular formula C11H14INS and a molecular weight of 319.21 g/mol. IUPAC name: 2-methyl-3-propyl-1,3-benzothiazol-3-ium iodide. InChIKey: UGRAXKCTCJHEGH-UHFFFAOYSA-M.
| Molecular formula | C11H14INS |
|---|---|
| Molecular weight | 319.21 g/mol |
| IUPAC name | 2-methyl-3-propyl-1,3-benzothiazol-3-ium iodide |
| InChIKey | UGRAXKCTCJHEGH-UHFFFAOYSA-M |
| SMILES | CCC[N+]1=C(SC2=CC=CC=C21)C.[I-] |
Computed by PubChem (NCBI)