CAS 60131-40-0 appears in our catalog under these names: Sodium rel-(2R,3R)-3-carboxy-2,3-dihydroxypropanoate, 98+%, Sodium rel-(2R,3R)-3-carboxy-2,3-dihydroxypropanoate, 98+%, 98+%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25g.
Sodium (2R,3R)-2,3,4-trihydroxy-4-oxobutanoate (CAS 60131-40-0) is a chemical compound with the molecular formula C4H5NaO6 and a molecular weight of 172.07 g/mol. IUPAC name: sodium (2R,3R)-2,3,4-trihydroxy-4-oxobutanoate. InChIKey: NKAAEMMYHLFEFN-ZVGUSBNCSA-M.
| Molecular formula | C4H5NaO6 |
|---|---|
| Molecular weight | 172.07 g/mol |
| IUPAC name | sodium (2R,3R)-2,3,4-trihydroxy-4-oxobutanoate |
| InChIKey | NKAAEMMYHLFEFN-ZVGUSBNCSA-M |
| SMILES | [C@@H]([C@H](C(=O)[O-])O)(C(=O)O)O.[Na+] |
Computed by PubChem (NCBI)