CAS 60143-00-2 appears in our catalog under these names: Buspirone Impurity 26, Buspirone Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
2-[1-(2-amino-2-oxoethyl)cyclopentyl]acetic acid (CAS 60143-00-2) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: 2-[1-(2-amino-2-oxoethyl)cyclopentyl]acetic acid. InChIKey: NVRYYLKFGYCPRK-UHFFFAOYSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 2-[1-(2-amino-2-oxoethyl)cyclopentyl]acetic acid |
| InChIKey | NVRYYLKFGYCPRK-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CC(=O)N)CC(=O)O |
Computed by PubChem (NCBI)