CAS 601454-35-7 is the registry number for (4-(3,6-Di-tert-butyl-9H-carbazol-9-yl)phenyl)boronic acid, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
[4-(3,6-ditert-butylcarbazol-9-yl)phenyl]boronic acid (CAS 601454-35-7) is a chemical compound with the molecular formula C26H30BNO2 and a molecular weight of 399.3 g/mol. IUPAC name: [4-(3,6-ditert-butylcarbazol-9-yl)phenyl]boronic acid. InChIKey: DXYUERNSBGXMBL-UHFFFAOYSA-N.
| Molecular formula | C26H30BNO2 |
|---|---|
| Molecular weight | 399.3 g/mol |
| IUPAC name | [4-(3,6-ditert-butylcarbazol-9-yl)phenyl]boronic acid |
| InChIKey | DXYUERNSBGXMBL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C(C)(C)C)C4=C2C=CC(=C4)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)