CAS 60160-25-0 appears in our catalog under these names: Bis(4-(1-phenylethyl)phenyl)amine 95%, 4-(1-Phenylethyl)-N-[4-(1-phenylethyl)phenyl]benzenamine, 95%, 95%, bis(4-(1-Phenylethyl)phenyl)amine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-(1-phenylethyl)-N-[4-(1-phenylethyl)phenyl]aniline (CAS 60160-25-0) is a chemical compound with the molecular formula C28H27N and a molecular weight of 377.5 g/mol. IUPAC name: 4-(1-phenylethyl)-N-[4-(1-phenylethyl)phenyl]aniline. InChIKey: BRWSDEFCJGIRLV-UHFFFAOYSA-N.
| Molecular formula | C28H27N |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | 4-(1-phenylethyl)-N-[4-(1-phenylethyl)phenyl]aniline |
| InChIKey | BRWSDEFCJGIRLV-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)C(C)C4=CC=CC=C4 |
Computed by PubChem (NCBI)