Products 60161-88-8

CAS 60161-88-8 is the registry number for (Diethoxyphosphoryl)methyl methacrylate 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Diethoxyphosphorylmethyl 2-methylprop-2-enoate (CAS 60161-88-8) is a chemical compound with the molecular formula C9H17O5P and a molecular weight of 236.20 g/mol. IUPAC name: diethoxyphosphorylmethyl 2-methylprop-2-enoate. InChIKey: WGEHZQBNIFSXDP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17O5P
Molecular weight236.20 g/mol
IUPAC namediethoxyphosphorylmethyl 2-methylprop-2-enoate
InChIKeyWGEHZQBNIFSXDP-UHFFFAOYSA-N
SMILESCCOP(=O)(COC(=O)C(=C)C)OCC

Computed by PubChem (NCBI)