Products 6018-53-7
CAS 6018-53-7 appears in our catalog under these names: D-Quinovosamine hydrochloride, D-Quinovosamine hydrochloride, 2 mg, D-Quinovosamine hydrochloride, 5 mg, D-Quinovosamine hydrochloride, 10 mg, D-Quinovosamine hydrochloride, 25 mg. Offered by: Biosynth, Roth. Available pack sizes: 5mg, 2mg, 10mg, 50mg, 25mg.
(2R,3R,4R,5R)-2-amino-3,4,5-trihydroxyhexanal (CAS 6018-53-7) is a chemical compound with the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. IUPAC name: (2R,3R,4R,5R)-2-amino-3,4,5-trihydroxyhexanal. InChIKey: NTBYIQWZAVDRHA-JGWLITMVSA-N.
| Molecular formula | C6H13NO4 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-amino-3,4,5-trihydroxyhexanal |
| InChIKey | NTBYIQWZAVDRHA-JGWLITMVSA-N |
| SMILES | C[C@H]([C@H]([C@@H]([C@H](C=O)N)O)O)O |
Computed by PubChem (NCBI)