CAS 60186-17-6 is the registry number for 2,4,6-Trifluoro-3-nitropyridine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2,4,6-trifluoro-3-nitropyridine (CAS 60186-17-6) is a chemical compound with the molecular formula C5HF3N2O2 and a molecular weight of 178.07 g/mol. IUPAC name: 2,4,6-trifluoro-3-nitropyridine. InChIKey: MWMMJUHXDRVMJO-UHFFFAOYSA-N.
| Molecular formula | C5HF3N2O2 |
|---|---|
| Molecular weight | 178.07 g/mol |
| IUPAC name | 2,4,6-trifluoro-3-nitropyridine |
| InChIKey | MWMMJUHXDRVMJO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1F)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)