CAS 60186-20-1 appears in our catalog under these names: 2,6-Difluoro-3-nitropyridin-4-amine, 95%, 95%, 2,6-Difluoro-3-nitropyridin-4-amine, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
2,6-difluoro-3-nitropyridin-4-amine (CAS 60186-20-1) is a chemical compound with the molecular formula C5H3F2N3O2 and a molecular weight of 175.09 g/mol. IUPAC name: 2,6-difluoro-3-nitropyridin-4-amine. InChIKey: KMDWOPYIFWBPRD-UHFFFAOYSA-N.
| Molecular formula | C5H3F2N3O2 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 2,6-difluoro-3-nitropyridin-4-amine |
| InChIKey | KMDWOPYIFWBPRD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1F)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)